Difference between revisions of "SJ14352"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * common-name: ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol * smile...")
(Created page with "Category:gene == Gene SJ14352 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] ==
+
== Gene SJ14352 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=c(c)c(o)=c1))c)c
+
* [[4.2.2.10-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** qfmvwsptqocgtb-tuzvqdltsa-n
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-14897]]
** 410.639
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
* [[RXN-14917]]
+
* [[PWY-7243]]
== Reaction(s) of unknown directionality ==
+
** '''1''' reactions found over '''n.a''' reactions in the full pathway
{{#set: common-name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
{{#set: inchi-key=inchikey=qfmvwsptqocgtb-tuzvqdltsa-n}}
+
{{#set: nb reaction associated=2}}
{{#set: molecular-weight=410.639}}
+
{{#set: nb pathway associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ14352

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7243
    • 1 reactions found over n.a reactions in the full pathway