Difference between revisions of "SJ14352"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-TRP-tRNAs Charged-TRP-tRNAs] == * common-name: ** an l-tryptophanyl-[trnatrp] == Reacti...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * common-name: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine |
| + | * smiles: | ||
| + | ** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** byeijzfkoaxbbv-qxewzrgksa-m | ||
| + | * molecular-weight: | ||
| + | ** 362.42 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.21.3.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}} |
| + | {{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}} | ||
| + | {{#set: molecular-weight=362.42}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY
- common-name:
- n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
- smiles:
- cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
- inchi-key:
- byeijzfkoaxbbv-qxewzrgksa-m
- molecular-weight:
- 362.42
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
