Difference between revisions of "SJ14361"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * common-name: ** 3-[(4'-methylthio)butyl]malate * smiles: ** csccccc(c(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nucleoside-Diphosphates Nucleoside-Diphosphates] == * common-name: ** a nucleoside diphosphate...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nucleoside-Diphosphates Nucleoside-Diphosphates] ==
 
* common-name:
 
* common-name:
** 3-[(4'-methylthio)butyl]malate
+
** a nucleoside diphosphate
* smiles:
 
** csccccc(c(o)c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** zizldvklmyvmnx-uhfffaoysa-l
 
* molecular-weight:
 
** 234.267
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18206]]
+
* [[2.7.4.10-RXN]]
* [[RXNQT-4168]]
+
* [[2.7.7.8-RXN]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18206]]
+
* [[2.7.4.10-RXN]]
 +
* [[2.7.7.8-RXN]]
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(4'-methylthio)butyl]malate}}
+
{{#set: common-name=a nucleoside diphosphate}}
{{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}}
 
{{#set: molecular-weight=234.267}}
 

Revision as of 14:20, 26 August 2019