Difference between revisions of "SJ14526"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-6P MANNOSE-6P] == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(...")
 
(Created page with "Category:gene == Gene SJ14526 == * transcription-direction: ** negative * right-end-position: ** 362545 * left-end-position: ** 353790 * centisome-position: ** 49.64519...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-6P MANNOSE-6P] ==
+
== Gene SJ14526 ==
−
* common-name:
+
* transcription-direction:
−
** α-d-mannopyranose 6-phosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
+
** 362545
−
* inchi-key:
+
* left-end-position:
−
** nbschqhzlsjfnq-pqmkyfcfsa-l
+
** 353790
−
* molecular-weight:
+
* centisome-position:
−
** 258.121
+
** 49.64519   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.4.17-RXN]]
−
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
+
** Category: [[annotation]]
−
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
+
** Category: [[orthology]]
−
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
−
{{#set: common-name=α-d-mannopyranose 6-phosphate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-pqmkyfcfsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=258.121}}
+
* [[RXN0-5038]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=362545}}
 +
{{#set: left-end-position=353790}}
 +
{{#set: centisome-position=49.64519    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ14526

  • transcription-direction:
    • negative
  • right-end-position:
    • 362545
  • left-end-position:
    • 353790
  • centisome-position:
    • 49.64519

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14526&oldid=132955"