Difference between revisions of "SJ14527"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
 
* common-name:
 
* common-name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** tetrahydrogeranylgeranyl diphosphate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
+
** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
* inchi-key:
** mwrbnpkjoowzpw-nyvomtagsa-n
+
** vzbgwadxujsbti-pyddkjgssa-k
 
* molecular-weight:
 
* molecular-weight:
** 744.043
+
** 451.456
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15036]]
+
* [[RXN-7659]]
* [[RXN-15067]]
+
* [[RXN-7660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[RXN-7659]]
 +
* [[RXN-7660]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: common-name=tetrahydrogeranylgeranyl diphosphate}}
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
+
{{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}}
{{#set: molecular-weight=744.043}}
+
{{#set: molecular-weight=451.456}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-7003

  • common-name:
    • tetrahydrogeranylgeranyl diphosphate
  • smiles:
    • cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
  • inchi-key:
    • vzbgwadxujsbti-pyddkjgssa-k
  • molecular-weight:
    • 451.456

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality