Difference between revisions of "SJ14529"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1344 CPD1G-1344] == * common-name: ** α, α'-trehalose 6-α-mycolate * sm...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xwecmahakfwynv-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 264.169 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12610]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xwecmahakfwynv-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=264.169}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-13576
- common-name:
- 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
- smiles:
- cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)
- inchi-key:
- xwecmahakfwynv-uhfffaoysa-k
- molecular-weight:
- 264.169
