Difference between revisions of "SJ14529"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * s...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] == * common-name: ** a malonyl-[acp] methyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] ==
 
* common-name:
 
* common-name:
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
+
** a malonyl-[acp] methyl ester
* smiles:
 
** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)
 
* inchi-key:
 
** xwecmahakfwynv-uhfffaoysa-k
 
* molecular-weight:
 
** 264.169
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12610]]
+
* [[RXN-11474]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11475]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
+
{{#set: common-name=a malonyl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=xwecmahakfwynv-uhfffaoysa-k}}
 
{{#set: molecular-weight=264.169}}
 

Revision as of 09:23, 27 August 2019

Metabolite Malonyl-acp-methyl-ester

  • common-name:
    • a malonyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a malonyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.