Difference between revisions of "SJ14535"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * common-name: ** benzoylsuccinyl-coa * smiles: **...")
(Created page with "Category:gene == Gene SJ09895 == * transcription-direction: ** negative * right-end-position: ** 223877 * left-end-position: ** 210318 * centisome-position: ** 51.997776...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Gene SJ09895 ==
−
* common-name:
+
* transcription-direction:
−
** benzoylsuccinyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** 223877
−
* inchi-key:
+
* left-end-position:
−
** sgnpjinsckfitg-ihebcorqsa-i
+
** 210318
−
* molecular-weight:
+
* centisome-position:
−
** 966.676
+
** 51.997776   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-905]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
−
{{#set: common-name=benzoylsuccinyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=966.676}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=223877}}
 +
{{#set: left-end-position=210318}}
 +
{{#set: centisome-position=51.997776    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:19, 18 December 2020

Gene SJ09895

  • transcription-direction:
    • negative
  • right-end-position:
    • 223877
  • left-end-position:
    • 210318
  • centisome-position:
    • 51.997776

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14535&oldid=40565"