Difference between revisions of "SJ14545"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-253 CPD-253] == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY-tRNAs GLY-tRNAs] == * common-name: ** a trnagly == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-253 CPD-253] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY-tRNAs GLY-tRNAs] ==
 
* common-name:
 
* common-name:
** 4,5-seco-dopa
+
** a trnagly
* smiles:
 
** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
 
* inchi-key:
 
** fnegjfdtwwxqes-qtwonppnsa-m
 
* molecular-weight:
 
** 228.181
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8460]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4,5-seco-dopa}}
+
{{#set: common-name=a trnagly}}
{{#set: inchi-key=inchikey=fnegjfdtwwxqes-qtwonppnsa-m}}
 
{{#set: molecular-weight=228.181}}
 

Revision as of 14:20, 26 August 2019

Metabolite GLY-tRNAs

  • common-name:
    • a trnagly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality