Difference between revisions of "SJ14633"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17541 CPD-17541] == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17541 CPD-17541] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
 
* common-name:
 
* common-name:
** dapdiamide c
+
** 3-oxo-(9z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
+
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mjpkmdapfrgjgv-fbfnwgnusa-n
+
** jdnargywmlyada-mdmkaecgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 314.341
+
** 1013.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17791]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16293]]
+
* [[RXN-17790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dapdiamide c}}
+
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=mjpkmdapfrgjgv-fbfnwgnusa-n}}
+
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
{{#set: molecular-weight=314.341}}
+
{{#set: molecular-weight=1013.883}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-19158

  • common-name:
    • 3-oxo-(9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jdnargywmlyada-mdmkaecgsa-j
  • molecular-weight:
    • 1013.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality