Difference between revisions of "SJ14633"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOSPINGOSINE PHYTOSPINGOSINE] == * common-name: ** phytosphingosine * smiles: ** ccccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOSPINGOSINE PHYTOSPINGOSINE] ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-hexadecenoyl-coa
+
** phytosphingosine
 
* smiles:
 
* smiles:
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccccccccccccccc(o)c(c(co)[n+])o
 
* inchi-key:
 
* inchi-key:
** jdnargywmlyada-mdmkaecgsa-j
+
** aerbncycjbrydg-kszliroesa-o
 
* molecular-weight:
 
* molecular-weight:
** 1013.883
+
** 318.519
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17791]]
+
* [[RXN3O-328]]
 +
* [[RXN3O-458]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
+
{{#set: common-name=phytosphingosine}}
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
+
{{#set: inchi-key=inchikey=aerbncycjbrydg-kszliroesa-o}}
{{#set: molecular-weight=1013.883}}
+
{{#set: molecular-weight=318.519}}

Revision as of 09:23, 27 August 2019

Metabolite PHYTOSPINGOSINE

  • common-name:
    • phytosphingosine
  • smiles:
    • ccccccccccccccc(o)c(c(co)[n+])o
  • inchi-key:
    • aerbncycjbrydg-kszliroesa-o
  • molecular-weight:
    • 318.519

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality