Difference between revisions of "SJ14672"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9859 CPD-9859] == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoqui...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] == * common-name: ** a 1,2-diglyceride == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9859 CPD-9859] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
+
** a 1,2-diglyceride
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** rohkdmwqxdhldy-hohoqcmasa-n
 
* molecular-weight:
 
** 630.993
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9227]]
+
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 +
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a 1,2-diglyceride}}
{{#set: inchi-key=inchikey=rohkdmwqxdhldy-hohoqcmasa-n}}
 
{{#set: molecular-weight=630.993}}
 

Revision as of 14:20, 26 August 2019

Metabolite 1-2-Diglycerides

  • common-name:
    • a 1,2-diglyceride

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality