Difference between revisions of "SJ14675"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCERALD GLYCERALD] == * common-name: ** d-glyceraldehyde * smiles: ** [ch](=o)c(o)co * inchi-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7246 CPD-7246] == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7246 CPD-7246] == |
* common-name: | * common-name: | ||
| − | ** d- | + | ** n-acetyl-α-d-galactosamine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** [ | + | ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fzljpepaypummr-jajwtyfosa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 299.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13760]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-13760]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=299.174}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-7246
- common-name:
- n-acetyl-α-d-galactosamine 1-phosphate
- smiles:
- cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
- inchi-key:
- fzljpepaypummr-jajwtyfosa-l
- molecular-weight:
- 299.174
