Difference between revisions of "SJ14677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8579 CPD-8579] == * common-name: ** a [histone] n6-methyl-l-lysine == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8579 CPD-8579] ==
 
* common-name:
 
* common-name:
** dump
+
** a [histone] n6-methyl-l-lysine
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
** jsrljpsbldheio-shyzeuofsa-l
 
* molecular-weight:
 
** 306.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MDUMT]]
 
* [[RXN-14143]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DCMP-DEAMINASE-RXN]]
+
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
* [[DUTNH]]
 
* [[DUTP-PYROP-RXN]]
 
* [[MDUMT]]
 
* [[RXN-14199]]
 
* [[RXN-14220]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dump}}
+
{{#set: common-name=a [histone] n6-methyl-l-lysine}}
{{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}}
 
{{#set: molecular-weight=306.168}}
 

Revision as of 14:19, 26 August 2019

Metabolite CPD-8579

  • common-name:
    • a [histone] n6-methyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [histone] n6-methyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.