Difference between revisions of "SJ14681"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerides Triacylglycerides] == * common-name: ** a triglyceride == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == |
* common-name: | * common-name: | ||
| − | ** | + | ** delphinidin-3-o-β-d-glucoside |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4))) | ||
| + | * inchi-key: | ||
| + | ** xenhpqqldpayij-pevlunpasa-m | ||
| + | * molecular-weight: | ||
| + | ** 463.374 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8228]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=delphinidin-3-o-β-d-glucoside}} |
| + | {{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}} | ||
| + | {{#set: molecular-weight=463.374}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-7117
- common-name:
- delphinidin-3-o-β-d-glucoside
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
- inchi-key:
- xenhpqqldpayij-pevlunpasa-m
- molecular-weight:
- 463.374
