Difference between revisions of "SJ14774"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * common-name: ** tetraiodothyroacetate ester glucuronide * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6082 CPD-6082] == * common-name: ** 3-aminopropanal * smiles: ** c(cc[n+])=o * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6082 CPD-6082] ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate ester glucuronide
+
** 3-aminopropanal
 
* smiles:
 
* smiles:
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3))
+
** c(cc[n+])=o
 
* inchi-key:
 
* inchi-key:
** xzmjvzbexskssm-kfyubchvsa-m
+
** pcxdjqzlddhmgx-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 922.95
+
** 74.102
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-6382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10617]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate ester glucuronide}}
+
{{#set: common-name=3-aminopropanal}}
{{#set: inchi-key=inchikey=xzmjvzbexskssm-kfyubchvsa-m}}
+
{{#set: inchi-key=inchikey=pcxdjqzlddhmgx-uhfffaoysa-o}}
{{#set: molecular-weight=922.95}}
+
{{#set: molecular-weight=74.102}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-6082

  • common-name:
    • 3-aminopropanal
  • smiles:
    • c(cc[n+])=o
  • inchi-key:
    • pcxdjqzlddhmgx-uhfffaoysa-o
  • molecular-weight:
    • 74.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality