Difference between revisions of "SJ14783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=n...")
(Created page with "Category:gene == Gene SJ14783 == * transcription-direction: ** negative * right-end-position: ** 28172 * left-end-position: ** 17323 * centisome-position: ** 5.5882087...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] ==
+
== Gene SJ14783 ==
* common-name:
+
* transcription-direction:
** adenosine 5'-phosphosulfate
+
** negative
* smiles:
+
* right-end-position:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
+
** 28172
* inchi-key:
+
* left-end-position:
** irlpacmltupbcl-kqynxxcusa-l
+
** 17323
* molecular-weight:
+
* centisome-position:
** 425.266
+
** 5.5882087   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.8.4.9-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[ADENYLYLSULFATASE-RXN]]
+
== Reaction(s) associated ==
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
* [[3.4.22.41-RXN]]
* [[ADENYLYLSULFKIN-RXN]]
+
** Category: [[annotation]]
* [[R163-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12019]]
+
{{#set: transcription-direction=negative}}
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
{{#set: right-end-position=28172}}
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
+
{{#set: left-end-position=17323}}
== Reaction(s) known to produce the compound ==
+
{{#set: centisome-position=5.5882087    }}
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[ADENYLYLSULFKIN-RXN]]
+
{{#set: nb reaction associated=1}}
* [[R163-RXN]]
 
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=adenosine 5'-phosphosulfate}}
 
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
 
{{#set: molecular-weight=425.266}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ14783

  • transcription-direction:
    • negative
  • right-end-position:
    • 28172
  • left-end-position:
    • 17323
  • centisome-position:
    • 5.5882087

Organism(s) associated with this gene

Reaction(s) associated