Difference between revisions of "SJ14783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoleoyl-ACPs Palmitoleoyl-ACPs] == * common-name: ** a palmitoleoyl-[acp] == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoleoyl-ACPs Palmitoleoyl-ACPs] ==
 
* common-name:
 
* common-name:
** adenosine 5'-phosphosulfate
+
** a palmitoleoyl-[acp]
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
 
* inchi-key:
 
** irlpacmltupbcl-kqynxxcusa-l
 
* molecular-weight:
 
** 425.266
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.9-RXN]]
+
* [[2.3.1.179-RXN]]
* [[ADENYLYLSULFATASE-RXN]]
+
* [[RXN-17012]]
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
* [[RXN-17013]]
* [[ADENYLYLSULFKIN-RXN]]
+
* [[RXN-17020]]
* [[R163-RXN]]
 
* [[RXN-12019]]
 
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
* [[RXN-10661]]
* [[ADENYLYLSULFKIN-RXN]]
 
* [[R163-RXN]]
 
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 5'-phosphosulfate}}
+
{{#set: common-name=a palmitoleoyl-[acp]}}
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
 
{{#set: molecular-weight=425.266}}
 

Revision as of 09:24, 27 August 2019

Metabolite Palmitoleoyl-ACPs

  • common-name:
    • a palmitoleoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a palmitoleoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.