Difference between revisions of "SJ14920"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * common-name: ** sn-glycerol 1-phosphate *...")
 
(Created page with "Category:gene == Gene SJ14920 == * transcription-direction: ** negative * right-end-position: ** 243733 * left-end-position: ** 237750 * centisome-position: ** 78.03192...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] ==
+
== Gene SJ14920 ==
* common-name:
+
* transcription-direction:
** sn-glycerol 1-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(op([o-])(=o)[o-])c(o)co
+
** 243733
* inchi-key:
+
* left-end-position:
** awucvroldviajx-vkhmyheasa-l
+
** 237750
* molecular-weight:
+
* centisome-position:
** 170.058
+
** 78.03192   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.5.1.41-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-14964]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.4.1.142-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=sn-glycerol 1-phosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}}
+
** Category: [[orthology]]
{{#set: molecular-weight=170.058}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 +
** '''16''' reactions found over '''19''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=243733}}
 +
{{#set: left-end-position=237750}}
 +
{{#set: centisome-position=78.03192    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ14920

  • transcription-direction:
    • negative
  • right-end-position:
    • 243733
  • left-end-position:
    • 237750
  • centisome-position:
    • 78.03192

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated