Difference between revisions of "SJ14933"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07766 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.21.53-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite XANTHOSINE == |
− | == | + | * common-name: |
− | * | + | ** xanthosine |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
− | * | + | * inchi-key: |
− | * | + | ** ubortcndukbeop-uuokfmhzsa-n |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 284.228 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-363]] | ||
+ | * [[XANTHOSINEPHOSPHORY-RXN]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[X5NT]] | ||
+ | * [[XMPXAN-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=xanthosine}} | ||
+ | {{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}} | ||
+ | {{#set: molecular-weight=284.228}} |
Revision as of 08:23, 15 March 2021
Contents
Metabolite XANTHOSINE
- common-name:
- xanthosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- ubortcndukbeop-uuokfmhzsa-n
- molecular-weight:
- 284.228