Difference between revisions of "SJ14968"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] == * common-name: ** coproporphyrin iii * smiles: ** cc1...")
(Created page with "Category:gene == Gene SJ16080 == * transcription-direction: ** negative * right-end-position: ** 118020 * left-end-position: ** 83102 * centisome-position: ** 28.846148...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] ==
+
== Gene SJ16080 ==
−
* common-name:
+
* transcription-direction:
−
** coproporphyrin iii
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
+
** 118020
−
* inchi-key:
+
* left-end-position:
−
** jwfcywsmnrlxlx-ujjxfscmsa-j
+
** 83102
−
* molecular-weight:
+
* centisome-position:
−
** 650.687
+
** 28.846148   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17518]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-17517]]
+
* [[DNA-LIGASE-ATP-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=coproporphyrin iii}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=650.687}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-17917]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-17918]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-17919]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=118020}}
 +
{{#set: left-end-position=83102}}
 +
{{#set: centisome-position=28.846148    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}

Revision as of 20:20, 18 December 2020

Gene SJ16080

  • transcription-direction:
    • negative
  • right-end-position:
    • 118020
  • left-end-position:
    • 83102
  • centisome-position:
    • 28.846148

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14968&oldid=41056"