Difference between revisions of "SJ15059"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SARCOSINE SARCOSINE] == * common-name: ** sarcosine * smiles: ** c[n+]cc(=o)[o-] * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SARCOSINE SARCOSINE] ==
 
* common-name:
 
* common-name:
** dethiobiotin
+
** sarcosine
 
* smiles:
 
* smiles:
** cc1(nc(=o)nc1cccccc(=o)[o-])
+
** c[n+]cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** autolbmxddtrrt-uhfffaoysa-m
+
** fsykklyzxjsnpz-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 213.256
+
** 89.094
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
+
* [[RXN-13405]]
* [[RXN-17472]]
+
* [[RXN-8673]]
 +
* [[RXN-9679]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DETHIOBIOTIN-SYN-RXN]]
+
* [[CREATINASE-RXN]]
 +
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dethiobiotin}}
+
{{#set: common-name=sarcosine}}
{{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=fsykklyzxjsnpz-uhfffaoysa-n}}
{{#set: molecular-weight=213.256}}
+
{{#set: molecular-weight=89.094}}

Revision as of 14:20, 26 August 2019

Metabolite SARCOSINE

  • common-name:
    • sarcosine
  • smiles:
    • c[n+]cc(=o)[o-]
  • inchi-key:
    • fsykklyzxjsnpz-uhfffaoysa-n
  • molecular-weight:
    • 89.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality