Difference between revisions of "SJ15062"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-dik...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** 3-sulfopyruvate
 
* smiles:
 
* smiles:
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** yjisldwviydioe-wgtgpsahsa-l
+
** buthmsuebypmkj-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 842.848
+
** 166.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15681]]
+
* [[R230-RXN]]
 +
* [[RXN-11737]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15680]]
+
* [[R230-RXN]]
 +
* [[RXN-11737]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=3-sulfopyruvate}}
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
+
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
{{#set: molecular-weight=842.848}}
+
{{#set: molecular-weight=166.105}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-380

  • common-name:
    • 3-sulfopyruvate
  • smiles:
    • c(=o)([o-])c(=o)cs(=o)(=o)[o-]
  • inchi-key:
    • buthmsuebypmkj-uhfffaoysa-l
  • molecular-weight:
    • 166.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality