Difference between revisions of "SJ15137"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] == * common-name: ** n2-form...")
(Created page with "Category:gene == Gene SJ15137 == * transcription-direction: ** positive * right-end-position: ** 156887 * left-end-position: ** 146863 * centisome-position: ** 48.791534...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] ==
+
== Gene SJ15137 ==
−
* common-name:
+
* transcription-direction:
−
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
+
** 156887
−
* inchi-key:
+
* left-end-position:
−
** vdxlundmvkskho-xvfcmesisa-l
+
** 146863
−
* molecular-weight:
+
* centisome-position:
−
** 312.172
+
** 48.791534   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[FGAMSYN-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[FGFTh]]
+
== Reaction(s) associated ==
−
* [[FPGFTh]]
+
* [[2.7.12.1-RXN]]
−
* [[GART-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[FPGFTh]]
+
* [[PROTEIN-KINASE-RXN]]
−
* [[GART-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
** Category: [[orthology]]
−
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: molecular-weight=312.172}}
+
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=156887}}
 +
{{#set: left-end-position=146863}}
 +
{{#set: centisome-position=48.791534    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:04, 18 March 2021

Gene SJ15137

  • transcription-direction:
    • positive
  • right-end-position:
    • 156887
  • left-end-position:
    • 146863
  • centisome-position:
    • 48.791534

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ15137&oldid=133526"