Difference between revisions of "SJ15137"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13516 == * transcription-direction: ** positive * right-end-position: ** 304276 * left-end-position: ** 239443 * centisome-position: ** 71.56118...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] == * common-name: ** n2-form...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] == |
| − | * | + | * common-name: |
| − | ** | + | ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide |
| − | * | + | * smiles: |
| − | ** | + | ** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** vdxlundmvkskho-xvfcmesisa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 312.172 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[FGAMSYN-RXN]] |
| − | + | * [[FGFTh]] | |
| − | * [[ | + | * [[FPGFTh]] |
| − | * | + | * [[GART-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[FPGFTh]] |
| − | + | * [[GART-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}} |
| − | + | {{#set: molecular-weight=312.172}} | |
Revision as of 09:25, 27 August 2019
Contents
Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE
- common-name:
- n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
- smiles:
- c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- vdxlundmvkskho-xvfcmesisa-l
- molecular-weight:
- 312.172
