Difference between revisions of "SJ15209"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14281 CPD-14281] == * common-name: ** trans-docos-2-enoyl-coa * smiles: ** cccccccccccccccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * common-name: ** 5-amino-6-(5-phospho-d-ribosylamino)uracil * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14281 CPD-14281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
 
* common-name:
 
* common-name:
** trans-docos-2-enoyl-coa
+
** 5-amino-6-(5-phospho-d-ribosylamino)uracil
 
* smiles:
 
* smiles:
** cccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
 
* inchi-key:
 
* inchi-key:
** krtifnfqcjtgmv-dyavhemfsa-j
+
** lzexycagpmyxlx-ummcilcdsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1084.06
+
** 352.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13307]]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10279/NAD//CPD-14281/NADH/PROTON.37.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13303]]
+
* [[RIBOFLAVINSYNDEAM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-docos-2-enoyl-coa}}
+
{{#set: common-name=5-amino-6-(5-phospho-d-ribosylamino)uracil}}
{{#set: inchi-key=inchikey=krtifnfqcjtgmv-dyavhemfsa-j}}
+
{{#set: inchi-key=inchikey=lzexycagpmyxlx-ummcilcdsa-l}}
{{#set: molecular-weight=1084.06}}
+
{{#set: molecular-weight=352.197}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-602

  • common-name:
    • 5-amino-6-(5-phospho-d-ribosylamino)uracil
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
  • inchi-key:
    • lzexycagpmyxlx-ummcilcdsa-l
  • molecular-weight:
    • 352.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality