Difference between revisions of "SJ15240"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * smiles: ** ccccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** α,α-trehalose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hdtrylnuvzcqoy-lizsdcnhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 342.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[TREHALA-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[TREHALOSEPHOSPHA-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α,α-trehalose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.299}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite TREHALOSE
- common-name:
- α,α-trehalose
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
- inchi-key:
- hdtrylnuvzcqoy-lizsdcnhsa-n
- molecular-weight:
- 342.299
