Difference between revisions of "SJ15309"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycerophosphodiesters Glycerophosphodiesters] == * common-name: ** a glycerophosphodiester ==...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * common-name: ** 2-trans, 4-cis-undecadienoyl-coa * smiles: ** ccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycerophosphodiesters Glycerophosphodiesters] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
 
* common-name:
 
* common-name:
** a glycerophosphodiester
+
** 2-trans, 4-cis-undecadienoyl-coa
 +
* smiles:
 +
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** szkpluulggerfd-nfpsboapsa-j
 +
* molecular-weight:
 +
** 927.749
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYCPDIESTER-RXN]]
+
* [[RXN-14776]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14775]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a glycerophosphodiester}}
+
{{#set: common-name=2-trans, 4-cis-undecadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=szkpluulggerfd-nfpsboapsa-j}}
 +
{{#set: molecular-weight=927.749}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-15654

  • common-name:
    • 2-trans, 4-cis-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-nfpsboapsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality