Difference between revisions of "SJ15409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=...")
 
(Created page with "Category:gene == Gene SJ15409 == * transcription-direction: ** negative * right-end-position: ** 262226 * left-end-position: ** 252122 * centisome-position: ** 85.07174...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] ==
+
== Gene SJ15409 ==
* common-name:
+
* transcription-direction:
** thiamine
+
** negative
* smiles:
+
* right-end-position:
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
+
** 262226
* inchi-key:
+
* left-end-position:
** jzrwcgzrtzmzeh-uhfffaoysa-n
+
** 252122
* molecular-weight:
+
* centisome-position:
** 265.352
+
** 85.07174   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ExchangeSeed-THIAMINE]]
+
* [[S.japonica_carotenoid_curated]]
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
+
== Reaction(s) associated ==
* [[THIAMINASE-RXN]]
+
* [[2.4.1.223-RXN]]
* [[TransportSeed-THIAMINE]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ExchangeSeed-THIAMINE]]
+
* [[2.4.1.94-RXN]]
* [[TransportSeed-THIAMINE]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=thiamine}}
+
* [[RXN-11889]]
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
+
** Category: [[annotation]]
{{#set: molecular-weight=265.352}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-11890]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-15205]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6558]]
 +
** '''7''' reactions found over '''13''' reactions in the full pathway
 +
* [[PWY-7437]]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=262226}}
 +
{{#set: left-end-position=252122}}
 +
{{#set: centisome-position=85.07174    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ15409

  • transcription-direction:
    • negative
  • right-end-position:
    • 262226
  • left-end-position:
    • 252122
  • centisome-position:
    • 85.07174

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6558
    • 7 reactions found over 13 reactions in the full pathway
  • PWY-7437
    • 1 reactions found over 2 reactions in the full pathway