Difference between revisions of "SJ15409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G-5-prime-PP-5-prime-DNA G-5-prime-PP-5-prime-DNA] == * common-name: ** guaosine-5'-diphospho-5...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G-5-prime-PP-5-prime-DNA G-5-prime-PP-5-prime-DNA] ==
 
* common-name:
 
* common-name:
** thiamine
+
** guaosine-5'-diphospho-5'-[dna]
* smiles:
 
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
** jzrwcgzrtzmzeh-uhfffaoysa-n
 
* molecular-weight:
 
** 265.352
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[RXN-17923]]
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMINASE-RXN]]
 
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[RXN-17922]]
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine}}
+
{{#set: common-name=guaosine-5'-diphospho-5'-[dna]}}
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
 
{{#set: molecular-weight=265.352}}
 

Revision as of 14:20, 26 August 2019

Metabolite G-5-prime-PP-5-prime-DNA

  • common-name:
    • guaosine-5'-diphospho-5'-[dna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "guaosine-5'-diphospho-5'-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.