Difference between revisions of "SJ15414"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RS-TETRAHYDROBENZYLISOQUINOLINE RS-TETRAHYDROBENZYLISOQUINOLINE] == * common-name: ** (r,s)-tet...")
(Created page with "Category:gene == Gene SJ15414 == * transcription-direction: ** negative * right-end-position: ** 291949 * left-end-position: ** 284811 * centisome-position: ** 96.10175...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RS-TETRAHYDROBENZYLISOQUINOLINE RS-TETRAHYDROBENZYLISOQUINOLINE] ==
+
== Gene SJ15414 ==
* common-name:
+
* transcription-direction:
** (r,s)-tetrahydrobenzylisoquinoline
+
** negative
* smiles:
+
* right-end-position:
** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
+
** 291949
* inchi-key:
+
* left-end-position:
** yrycifuzsumaay-uhfffaoysa-o
+
** 284811
* molecular-weight:
+
* centisome-position:
** 224.325
+
** 96.10175   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.1.1.115-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RXN-8668]]
{{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=224.325}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=291949}}
 +
{{#set: left-end-position=284811}}
 +
{{#set: centisome-position=96.10175    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ15414

  • transcription-direction:
    • negative
  • right-end-position:
    • 291949
  • left-end-position:
    • 284811
  • centisome-position:
    • 96.10175

Organism(s) associated with this gene

Reaction(s) associated