Difference between revisions of "SJ15414"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-SP-2Fe2S-Complex CD-SP-2Fe2S-Complex] == * common-name: ** a [cysteine desulfurase]-[scaffol...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** nω-phosphocreatine |
| + | * smiles: | ||
| + | ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] | ||
| + | * inchi-key: | ||
| + | ** drbbfclwyrjsjz-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 209.098 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[CREATINE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[CREATINE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nω-phosphocreatine}} |
| + | {{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=209.098}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CREATINE-P
- common-name:
- nω-phosphocreatine
- smiles:
- c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
- inchi-key:
- drbbfclwyrjsjz-uhfffaoysa-l
- molecular-weight:
- 209.098
