Difference between revisions of "SJ15440"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * common-name: ** 5-methyltetrahydropteroyl tri-l-glutamate * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12126 CPD-12126] == * common-name: ** menaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12126 CPD-12126] ==
 
* common-name:
 
* common-name:
** 5-methyltetrahydropteroyl tri-l-glutamate
+
** menaquinol-9
 
* smiles:
 
* smiles:
** cn1([ch](cnc2(n=c(nc(=o)c1=2)n))cnc3(=cc=c(c(=o)nc(c([o-])=o)ccc(nc(c([o-])=o)ccc(nc(c([o-])=o)ccc(=o)[o-])=o)=o)c=c3))
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
* inchi-key:
** hvrnkdvlfavcjf-vjantymqsa-j
+
** knwzipkbogoffc-uvzvdvbnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 713.66
+
** 787.263
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HOMOCYSMET-RXN]]
 
* [[RXN-12730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMOCYSMET-RXN]]
+
* [[RXN-9205]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methyltetrahydropteroyl tri-l-glutamate}}
+
{{#set: common-name=menaquinol-9}}
{{#set: inchi-key=inchikey=hvrnkdvlfavcjf-vjantymqsa-j}}
+
{{#set: inchi-key=inchikey=knwzipkbogoffc-uvzvdvbnsa-n}}
{{#set: molecular-weight=713.66}}
+
{{#set: molecular-weight=787.263}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12126

  • common-name:
    • menaquinol-9
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • knwzipkbogoffc-uvzvdvbnsa-n
  • molecular-weight:
    • 787.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality