Difference between revisions of "SJ15446"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...") |
(Created page with "Category:gene == Gene SJ15446 == * transcription-direction: ** positive * right-end-position: ** 80221 * left-end-position: ** 59008 * centisome-position: ** 19.963327...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ15446 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 80221 |
− | * | + | * left-end-position: |
− | ** | + | ** 59008 |
− | * | + | * centisome-position: |
− | ** | + | ** 19.963327 |
− | + | == Organism(s) associated with this gene == | |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | * [[ | + | == Reaction(s) associated == |
− | == | + | * [[NITRATE-REDUCTASE-NADH-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | = | + | ** Category: [[orthology]] |
− | {{#set: | + | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a |
− | {{#set: | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | {{#set: | + | * [[NITRATE-REDUCTASE-NADPH-RXN]] |
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | ** Category: [[orthology]] | ||
+ | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
+ | * [[NITRATE-REDUCTASE-NADPORNOPH-RXN]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | ** Category: [[orthology]] | ||
+ | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
+ | * [[NITRATREDUCT-RXN]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | == Pathway(s) associated == | ||
+ | * [[PWY-381]] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-5675]] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=80221}} | ||
+ | {{#set: left-end-position=59008}} | ||
+ | {{#set: centisome-position=19.963327 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=4}} | ||
+ | {{#set: nb pathway associated=2}} |
Latest revision as of 11:11, 18 March 2021
Contents
Gene SJ15446
- transcription-direction:
- positive
- right-end-position:
- 80221
- left-end-position:
- 59008
- centisome-position:
- 19.963327
Organism(s) associated with this gene
Reaction(s) associated
- NITRATE-REDUCTASE-NADH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_nannochloropsis_salina; tool: pantograph; comment: n.a
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NITRATE-REDUCTASE-NADPH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NITRATE-REDUCTASE-NADPORNOPH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NITRATREDUCT-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-381
- 3 reactions found over 3 reactions in the full pathway
- PWY-5675
- 4 reactions found over 4 reactions in the full pathway