Difference between revisions of "SJ15607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctano...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] == * common-name: ** a stearoyl-[acp] == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
+
** a stearoyl-[acp]
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** yyccmactoajggw-ozvhgmpnsa-j
 
* molecular-weight:
 
** 1053.904
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10699]]
+
* [[RXN-16024]]
 +
* [[RXN-16076]]
 +
* [[RXN-9548]]
 +
* [[RXN1G-368]]
 +
* [[RXN3O-5304]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10698]]
+
* [[RXN-9635]]
 +
* [[RXN3O-5293]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
+
{{#set: common-name=a stearoyl-[acp]}}
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}
 
{{#set: molecular-weight=1053.904}}
 

Revision as of 09:24, 27 August 2019

Metabolite Stearoyl-ACPs

  • common-name:
    • a stearoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a stearoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.