Difference between revisions of "SJ15629"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1074 CPD0-1074] == * common-name: ** aminomethylphosphonate * smiles: ** c(p([o-])(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1074 CPD0-1074] ==
 
* common-name:
 
* common-name:
** 6-trans-3-oxo-tridecenoyl-coa
+
** aminomethylphosphonate
 
* smiles:
 
* smiles:
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(p([o-])(=o)[o-])[n+]
 
* inchi-key:
 
* inchi-key:
** fdxhxlpclxeysu-hmxwsvnbsa-j
+
** mgrvrxrgtboshw-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 971.802
+
** 110.029
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14788]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17951]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=aminomethylphosphonate}}
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}}
+
{{#set: inchi-key=inchikey=mgrvrxrgtboshw-uhfffaoysa-m}}
{{#set: molecular-weight=971.802}}
+
{{#set: molecular-weight=110.029}}

Revision as of 09:25, 27 August 2019

Metabolite CPD0-1074

  • common-name:
    • aminomethylphosphonate
  • smiles:
    • c(p([o-])(=o)[o-])[n+]
  • inchi-key:
    • mgrvrxrgtboshw-uhfffaoysa-m
  • molecular-weight:
    • 110.029

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality