Difference between revisions of "SJ15630"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13473 CPD-13473] == * common-name: ** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glu...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14766 CPD-14766] == * common-name: ** 2-hydroxyhexadecanal * smiles: ** ccccccccccccccc(o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13473 CPD-13473] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14766 CPD-14766] ==
 
* common-name:
 
* common-name:
** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine
+
** 2-hydroxyhexadecanal
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
** ccccccccccccccc(o)[ch]=o
 
* inchi-key:
 
* inchi-key:
** dlgjwsvwtwewbj-zdlrkiohsa-m
+
** bkbdvqvdrvgxkt-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 378.312
+
** 256.428
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16485]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13729]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine}}
+
{{#set: common-name=2-hydroxyhexadecanal}}
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-zdlrkiohsa-m}}
+
{{#set: inchi-key=inchikey=bkbdvqvdrvgxkt-uhfffaoysa-n}}
{{#set: molecular-weight=378.312}}
+
{{#set: molecular-weight=256.428}}

Revision as of 09:25, 27 August 2019

Metabolite CPD-14766

  • common-name:
    • 2-hydroxyhexadecanal
  • smiles:
    • ccccccccccccccc(o)[ch]=o
  • inchi-key:
    • bkbdvqvdrvgxkt-uhfffaoysa-n
  • molecular-weight:
    • 256.428

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality