Difference between revisions of "SJ15668"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] == * common-name: ** (3r)-hydroxy-tetracosapentaenoyl-coa * smiles: ** ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine13 tRNA-uridine13] == * common-name: ** a uridine13 in trna == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine13 tRNA-uridine13] ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-tetracosapentaenoyl-coa
+
** a uridine13 in trna
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** drqaurckckdinz-kpyxopptsa-j
 
* molecular-weight:
 
** 1120.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16130]]
+
* [[RXN-11841]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16129]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-tetracosapentaenoyl-coa}}
+
{{#set: common-name=a uridine13 in trna}}
{{#set: inchi-key=inchikey=drqaurckckdinz-kpyxopptsa-j}}
 
{{#set: molecular-weight=1120.05}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-uridine13

  • common-name:
    • a uridine13 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality