Difference between revisions of "SJ15727"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19339 CPD-19339] == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11855 CPD-11855] == * common-name: ** (r)-4-hydroxy-4-methyl-2-oxoglutarate * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11855 CPD-11855] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-4-hydroxy-4-methyl-2-oxoglutarate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)(cc(c(=o)[o-])=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yrwamsxhybbhfl-zcfiwibfsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.11 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12074]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12074]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-4-hydroxy-4-methyl-2-oxoglutarate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yrwamsxhybbhfl-zcfiwibfsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.11}} |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPD-11855
- common-name:
- (r)-4-hydroxy-4-methyl-2-oxoglutarate
- smiles:
- cc(o)(cc(c(=o)[o-])=o)c([o-])=o
- inchi-key:
- yrwamsxhybbhfl-zcfiwibfsa-l
- molecular-weight:
- 174.11
