Difference between revisions of "SJ15771"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide...")
(Created page with "Category:gene == Gene SJ07328 == * transcription-direction: ** negative * right-end-position: ** 43773 * left-end-position: ** 20924 * centisome-position: ** 30.247921...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
+
== Gene SJ07328 ==
−
* common-name:
+
* transcription-direction:
−
** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
+
** negative
−
* smiles:
+
* right-end-position:
−
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
+
** 43773
−
* inchi-key:
+
* left-end-position:
−
** lqmbvwcqwfepfk-dkbymcrtsa-m
+
** 20924
−
* molecular-weight:
+
* centisome-position:
−
** 826.095
+
** 30.247921   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-10609]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.6.12-RXN]]
−
{{#set: common-name=3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=lqmbvwcqwfepfk-dkbymcrtsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=826.095}}
+
* [[ARYLSULFAT-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=43773}}
 +
{{#set: left-end-position=20924}}
 +
{{#set: centisome-position=30.247921    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:21, 18 December 2020

Gene SJ07328

  • transcription-direction:
    • negative
  • right-end-position:
    • 43773
  • left-end-position:
    • 20924
  • centisome-position:
    • 30.247921

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ15771&oldid=41710"