Difference between revisions of "SJ15784"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-10 tRNA-Containing-N2-Methylguanine-10] == * common-name: ** a...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETALDEHYDE 5-HYDROXYINDOLE_ACETALDEHYDE] == * common-name: ** 5-hydroxyindole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETALDEHYDE 5-HYDROXYINDOLE_ACETALDEHYDE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxyindole acetaldehyde |
| + | * smiles: | ||
| + | ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) | ||
| + | * inchi-key: | ||
| + | ** obfapciusyhfie-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 175.187 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10780]] | ||
| + | * [[RXN-10781]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10778]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetaldehyde}} |
| + | {{#set: inchi-key=inchikey=obfapciusyhfie-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=175.187}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE
- common-name:
- 5-hydroxyindole acetaldehyde
- smiles:
- c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o))
- inchi-key:
- obfapciusyhfie-uhfffaoysa-n
- molecular-weight:
- 175.187
