Difference between revisions of "SJ15809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] == * common-name: ** glutathione * smiles: ** c(s)c(c(ncc([o-])=o)=o)n...")
 
(Created page with "Category:gene == Gene SJ15809 == * transcription-direction: ** negative * right-end-position: ** 403574 * left-end-position: ** 385036 * centisome-position: ** 55.47198...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] ==
+
== Gene SJ15809 ==
* common-name:
+
* transcription-direction:
** glutathione
+
** negative
* smiles:
+
* right-end-position:
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** 403574
* inchi-key:
+
* left-end-position:
** rwsxrvcmgqzwbv-wdskdsinsa-m
+
** 385036
* molecular-weight:
+
* centisome-position:
** 306.313
+
** 55.47198   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.11.1.12-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[1.8.4.9-RXN]]
+
== Reaction(s) associated ==
* [[1.8.5.1-RXN]]
+
* [[ATPASE-RXN]]
* [[2.3.2.15-RXN]]
+
** Category: [[annotation]]
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GLYOXI-RXN]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
* [[GSHTRAN-RXN]]
+
** Category: [[annotation]]
* [[GST-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GTHP]]
+
* [[RXN-12195]]
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
+
** Category: [[annotation]]
* [[RXN-12618]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-13673]]
+
* [[RXN-12196]]
* [[RXN-15680]]
+
** Category: [[annotation]]
* [[RXN-18092]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-6601]]
+
* [[RXN0-5462]]
* [[RXN-9157]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GDR]]
+
== Pathway(s) associated ==
* [[GDR_LPAREN_nadp_RPAREN_]]
+
* [[PWY-6545]]
* [[GDR_LPAREN_nadp_RPAREN_h]]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
* [[GDR_LPAREN_nadp_RPAREN_m]]
+
* [[PWY-7210]]
* [[GDRh]]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
* [[GDRm]]
+
* [[PWY-7198]]
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
* [[GLUTATHIONE-SYN-RXN]]
+
* [[PWY-7184]]
* [[GLYOXI-RXN]]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
* [[GLYOXII-RXN]]
+
{{#set: transcription-direction=negative}}
* [[GST-RXN]]
+
{{#set: right-end-position=403574}}
* [[RXN-13161]]
+
{{#set: left-end-position=385036}}
* [[RXN-7919]]
+
{{#set: centisome-position=55.47198    }}
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=5}}
{{#set: common-name=glutathione}}
+
{{#set: nb pathway associated=4}}
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
 
{{#set: molecular-weight=306.313}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ15809

  • transcription-direction:
    • negative
  • right-end-position:
    • 403574
  • left-end-position:
    • 385036
  • centisome-position:
    • 55.47198

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway