Difference between revisions of "SJ15816"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytosine2870-in-25S-rRNA Cytosine2870-in-25S-rRNA] == * common-name: ** a cytosine2870 in 25s r...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * common-name: ** l-threonine 3-o-phosp...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** l-threonine 3-o-phosphate |
+ | * smiles: | ||
+ | ** cc(op([o-])([o-])=o)c([n+])c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** usrgiujoyoxoqj-gbxijsldsa-l | ||
+ | * molecular-weight: | ||
+ | ** 197.084 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[4.1.1.81-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-threonine 3-o-phosphate}} |
+ | {{#set: inchi-key=inchikey=usrgiujoyoxoqj-gbxijsldsa-l}} | ||
+ | {{#set: molecular-weight=197.084}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite L-THREONINE-O-3-PHOSPHATE
- common-name:
- l-threonine 3-o-phosphate
- smiles:
- cc(op([o-])([o-])=o)c([n+])c([o-])=o
- inchi-key:
- usrgiujoyoxoqj-gbxijsldsa-l
- molecular-weight:
- 197.084