Difference between revisions of "SJ15928"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == * common-name: ** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] ==
 
* common-name:
 
* common-name:
** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa
+
** α-d-xylose 1-phosphate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** avrcofdawhwkmb-mnthwfihsa-j
+
** ilxhfxfppzgenn-kkqcnmdgsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1104.05
+
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.7.11-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17110]]
+
* [[2.7.7.11-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa}}
+
{{#set: common-name=α-d-xylose 1-phosphate}}
{{#set: inchi-key=inchikey=avrcofdawhwkmb-mnthwfihsa-j}}
+
{{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}}
{{#set: molecular-weight=1104.05}}
+
{{#set: molecular-weight=228.095}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-490

  • common-name:
    • α-d-xylose 1-phosphate
  • smiles:
    • c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
  • inchi-key:
    • ilxhfxfppzgenn-kkqcnmdgsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality