Difference between revisions of "SJ15929"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] == * common-name: ** n2-form...")
 
(Created page with "Category:gene == Gene SJ16600 == * transcription-direction: ** negative * right-end-position: ** 372478 * left-end-position: ** 366323 * centisome-position: ** 53.601055...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] ==
+
== Gene SJ16600 ==
* common-name:
+
* transcription-direction:
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
+
** negative
* smiles:
+
* right-end-position:
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
+
** 372478
* inchi-key:
+
* left-end-position:
** vdxlundmvkskho-xvfcmesisa-l
+
** 366323
* molecular-weight:
+
* centisome-position:
** 312.172
+
** 53.601055   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[FGAMSYN-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[FGFTh]]
+
== Reaction(s) associated ==
* [[FPGFTh]]
+
* [[GLYOXII-RXN]]
* [[GART-RXN]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[FPGFTh]]
+
** Category: [[orthology]]
* [[GART-RXN]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
* [[RXN-7919]]
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}
+
** Category: [[annotation]]
{{#set: molecular-weight=312.172}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-5386]]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=372478}}
 +
{{#set: left-end-position=366323}}
 +
{{#set: centisome-position=53.601055    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 14:20, 26 August 2019

Gene SJ16600

  • transcription-direction:
    • negative
  • right-end-position:
    • 372478
  • left-end-position:
    • 366323
  • centisome-position:
    • 53.601055

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5386
    • 2 reactions found over 3 reactions in the full pathway