Difference between revisions of "SJ15967"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc...")
(Created page with "Category:gene == Gene SJ15967 == * transcription-direction: ** positive * right-end-position: ** 198793 * left-end-position: ** 192166 * centisome-position: ** 66.52703...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
+
== Gene SJ15967 ==
* common-name:
+
* transcription-direction:
** 3-[(7'-methylthio)heptyl]malate
+
** positive
* smiles:
+
* right-end-position:
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** 198793
* inchi-key:
+
* left-end-position:
** sxljfgxgvbwoob-uhfffaoysa-l
+
** 192166
* molecular-weight:
+
* centisome-position:
** 276.347
+
** 66.52703   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-18200]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXNQT-4178]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[1.18.1.2-RXN]]
* [[RXN-18200]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=3-[(7'-methylthio)heptyl]malate}}
+
* [[RXN-17897]]
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
+
** Category: [[annotation]]
{{#set: molecular-weight=276.347}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-101]]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=198793}}
 +
{{#set: left-end-position=192166}}
 +
{{#set: centisome-position=66.52703    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ15967

  • transcription-direction:
    • positive
  • right-end-position:
    • 198793
  • left-end-position:
    • 192166
  • centisome-position:
    • 66.52703

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-101
    • 2 reactions found over 4 reactions in the full pathway