Difference between revisions of "SJ15992"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHTYOSPHINGOSINE-1-P PHTYOSPHINGOSINE-1-P] == * common-name: ** phytosphingosine 1-phosphate *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15425 CPD-15425] == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHTYOSPHINGOSINE-1-P PHTYOSPHINGOSINE-1-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15425 CPD-15425] ==
 
* common-name:
 
* common-name:
** phytosphingosine 1-phosphate
+
** 6''-o-carbamoylkanamycin a
 
* smiles:
 
* smiles:
** ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o
+
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
* inchi-key:
** aygoskultisfcw-kszliroesa-m
+
** prwqrpnqdikfbr-noamyhissa-r
 
* molecular-weight:
 
* molecular-weight:
** 396.483
+
** 531.559
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13729]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-458]]
+
* [[RXN-13167]]
 +
* [[RXN-15285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytosphingosine 1-phosphate}}
+
{{#set: common-name=6''-o-carbamoylkanamycin a}}
{{#set: inchi-key=inchikey=aygoskultisfcw-kszliroesa-m}}
+
{{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}}
{{#set: molecular-weight=396.483}}
+
{{#set: molecular-weight=531.559}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-15425

  • common-name:
    • 6-o-carbamoylkanamycin a
  • smiles:
    • c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • prwqrpnqdikfbr-noamyhissa-r
  • molecular-weight:
    • 531.559

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality