Difference between revisions of "SJ16019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == * common-name: ** (9z,12z,15z,18z)-tetracosatetraenoyl-coa * smiles: **...")
(Created page with "Category:gene == Gene SJ16019 == * transcription-direction: ** positive * right-end-position: ** 310135 * left-end-position: ** 294174 * centisome-position: ** 42.540386...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] ==
+
== Gene SJ16019 ==
−
* common-name:
+
* transcription-direction:
−
** (9z,12z,15z,18z)-tetracosatetraenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 310135
−
* inchi-key:
+
* left-end-position:
−
** okoxeytyhdptew-gjykhrjnsa-j
+
** 294174
−
* molecular-weight:
+
* centisome-position:
−
** 1106.066
+
** 42.540386   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17112]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[HOMOSERDEHYDROG-RXN]]
−
{{#set: common-name=(9z,12z,15z,18z)-tetracosatetraenoyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=okoxeytyhdptew-gjykhrjnsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=1106.066}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[HOMOSERSYN-PWY]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=310135}}
 +
{{#set: left-end-position=294174}}
 +
{{#set: centisome-position=42.540386    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ16019

  • transcription-direction:
    • positive
  • right-end-position:
    • 310135
  • left-end-position:
    • 294174
  • centisome-position:
    • 42.540386

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ16019&oldid=133050"