Difference between revisions of "SJ16030"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-21-CP-39-keto-40-Me-C60-ACPs cis-21-CP-39-keto-40-Me-C60-ACPs] == * common-name: ** a cis-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-21-CP-39-keto-40-Me-C60-ACPs cis-21-CP-39-keto-40-Me-C60-ACPs] ==
 
* common-name:
 
* common-name:
** l-idonate
+
** a cis-keto-c60-meroacyl-[acp]
* smiles:
 
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 
* inchi-key:
 
** rghnjxzeokukbd-sknvomklsa-m
 
* molecular-weight:
 
** 195.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12107]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-3641]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-idonate}}
+
{{#set: common-name=a cis-keto-c60-meroacyl-[acp]}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}}
 
{{#set: molecular-weight=195.149}}
 

Revision as of 14:20, 26 August 2019

Metabolite cis-21-CP-39-keto-40-Me-C60-ACPs

  • common-name:
    • a cis-keto-c60-meroacyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-keto-c60-meroacyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.