Difference between revisions of "SJ16038"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG0 HG0] == * common-name: ** hg0 * smiles: ** [hg] * inchi-key: ** qshddoujbyecft-uhfffaoysa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG0 HG0] ==
 
* common-name:
 
* common-name:
** guanosine
+
** hg0
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** [hg]
 
* inchi-key:
 
* inchi-key:
** nyhbqmygnkiuif-uuokfmhzsa-n
+
** qshddoujbyecft-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 283.243
+
** 200.59
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-366]]
 
* [[RXN0-5199]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7609]]
+
* [[MERCURY-II-REDUCTASE-RXN]]
* [[RXN0-5199]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine}}
+
{{#set: common-name=hg0}}
{{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}}
+
{{#set: inchi-key=inchikey=qshddoujbyecft-uhfffaoysa-n}}
{{#set: molecular-weight=283.243}}
+
{{#set: molecular-weight=200.59}}

Revision as of 14:19, 26 August 2019

Metabolite HG0

  • common-name:
    • hg0
  • smiles:
    • [hg]
  • inchi-key:
    • qshddoujbyecft-uhfffaoysa-n
  • molecular-weight:
    • 200.59

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality